C14H13ClFN3O2 — CID 82718060
4-(4-chloro-3-fluorophenoxy)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide (PubChem CID 82718060) has the molecular formula C14H13ClFN3O2 and a molecular weight of 309.73 g/mol. Its IUPAC name is 4-(4-chloro-3-fluorophenoxy)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide.
| Compound Name | 4-(4-chloro-3-fluorophenoxy)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 82718060 |
| Molecular Formula | C14H13ClFN3O2 |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 4-(4-chloro-3-fluorophenoxy)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide |
| SMILES | Cc1cc(Oc2ccc(Cl)c(F)c2)c(/C(N)=N/O)c(C)n1 |
| InChI | InChI=1S/C14H13ClFN3O2/c1-7-5-12(13(8(2)18-7)14(17)19-20)21-9-3-4-10(15)11(16)6-9/h3-6,20H,1-2H3,(H2,17,19) |
| InChIKey | MTKHJFAXPAACCA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|