C15H24N2O2S — CID 82718173
N-(2-methoxyethyl)-2-methyl-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxolan-3-amine (PubChem CID 82718173) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methyl-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxolan-3-amine.
| Compound Name | N-(2-methoxyethyl)-2-methyl-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 82718173 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-methyl-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxolan-3-amine |
| SMILES | COCCNC1(c2nc3c(s2)CCCC3)CCOC1C |
| InChI | InChI=1S/C15H24N2O2S/c1-11-15(7-9-19-11,16-8-10-18-2)14-17-12-5-3-4-6-13(12)20-14/h11,16H,3-10H2,1-2H3 |
| InChIKey | UQHBNOQPHUKNIM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|