C10H22N2O — CID 82718601
3-(aminomethyl)-N,2-dimethyl-N-propyloxolan-3-amine (PubChem CID 82718601) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-(aminomethyl)-N,2-dimethyl-N-propyloxolan-3-amine.
| Compound Name | 3-(aminomethyl)-N,2-dimethyl-N-propyloxolan-3-amine |
|---|---|
| PubChem CID | 82718601 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 3-(aminomethyl)-N,2-dimethyl-N-propyloxolan-3-amine |
| SMILES | CCCN(C)C1(CN)CCOC1C |
| InChI | InChI=1S/C10H22N2O/c1-4-6-12(3)10(8-11)5-7-13-9(10)2/h9H,4-8,11H2,1-3H3 |
| InChIKey | BUQXHEFNMLFDIB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |