About 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine
3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine (PubChem CID 82719440) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine.
Molecular Properties
| Compound Name | 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine |
| PubChem CID | 82719440 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine |
| SMILES | CC1OCCC1(N)c1noc(C2CC2)n1 |
| InChI | InChI=1S/C10H15N3O2/c1-6-10(11,4-5-14-6)9-12-8(15-13-9)7-2-3-7/h6-7H,2-5,11H2,1H3 |
| InChIKey | MCTOXDAZNYOTJF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine?
The IUPAC name of 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine (CID 82719440) is 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine.
What is the SMILES notation for 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine?
The canonical SMILES for 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine is CC1OCCC1(N)c1noc(C2CC2)n1.
What is the InChIKey of 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine?
The InChIKey is MCTOXDAZNYOTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-6-10(11,4-5-14-6)9-12-8(15-13-9)7-2-3-7/h6-7H,2-5,11H2,1H3.
What are the key properties of 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine?
3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine has a molecular weight of 209.25 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-methyloxolan-3-amine is sourced from PubChem (CID 82719440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).