About 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine
6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine (PubChem CID 82719479) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine.
Molecular Properties
| Compound Name | 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine |
| PubChem CID | 82719479 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine |
| SMILES | CC1OCCC12CN=C(N)O2 |
| InChI | InChI=1S/C7H12N2O2/c1-5-7(2-3-10-5)4-9-6(8)11-7/h5H,2-4H2,1H3,(H2,8,9) |
| InChIKey | FZOUIHZZDXEALH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine?
The IUPAC name of 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine (CID 82719479) is 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine.
What is the SMILES notation for 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine?
The canonical SMILES for 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine is CC1OCCC12CN=C(N)O2.
What is the InChIKey of 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine?
The InChIKey is FZOUIHZZDXEALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-5-7(2-3-10-5)4-9-6(8)11-7/h5H,2-4H2,1H3,(H2,8,9).
What are the key properties of 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine?
6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine has a molecular weight of 156.18 g/mol, XLogP of -0.12, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,7-dioxa-3-azaspiro[4.4]non-2-en-2-amine is sourced from PubChem (CID 82719479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).