About [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine
[3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine (PubChem CID 82719724) has the molecular formula C14H10ClFN2O
and a molecular weight of 276.70 g/mol. Its IUPAC name is [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine |
| PubChem CID | 82719724 |
| Molecular Formula | C14H10ClFN2O |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine |
| SMILES | NCc1cccc(-c2nc3cc(Cl)c(F)cc3o2)c1 |
| InChI | InChI=1S/C14H10ClFN2O/c15-10-5-12-13(6-11(10)16)19-14(18-12)9-3-1-2-8(4-9)7-17/h1-6H,7,17H2 |
| InChIKey | IMIYMHSFWUTKSW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine?
The IUPAC name of [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine (CID 82719724) is [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine.
What is the SMILES notation for [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine?
The canonical SMILES for [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine is NCc1cccc(-c2nc3cc(Cl)c(F)cc3o2)c1.
What is the InChIKey of [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine?
The InChIKey is IMIYMHSFWUTKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClFN2O/c15-10-5-12-13(6-11(10)16)19-14(18-12)9-3-1-2-8(4-9)7-17/h1-6H,7,17H2.
What are the key properties of [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine?
[3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine has a molecular weight of 276.70 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)phenyl]methanamine is sourced from PubChem (CID 82719724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).