About 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline
2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline (PubChem CID 82720137) has the molecular formula C15H12ClFN2O
and a molecular weight of 290.73 g/mol. Its IUPAC name is 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline.
Molecular Properties
| Compound Name | 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline |
| PubChem CID | 82720137 |
| Molecular Formula | C15H12ClFN2O |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N)c(-c2nc3cc(Cl)c(F)cc3o2)c1 |
| InChI | InChI=1S/C15H12ClFN2O/c1-7-3-8(2)14(18)9(4-7)15-19-12-5-10(16)11(17)6-13(12)20-15/h3-6H,18H2,1-2H3 |
| InChIKey | NFAHAUPESIKWNW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline?
The IUPAC name of 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline (CID 82720137) is 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline.
What is the SMILES notation for 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline?
The canonical SMILES for 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline is Cc1cc(C)c(N)c(-c2nc3cc(Cl)c(F)cc3o2)c1.
What is the InChIKey of 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline?
The InChIKey is NFAHAUPESIKWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClFN2O/c1-7-3-8(2)14(18)9(4-7)15-19-12-5-10(16)11(17)6-13(12)20-15/h3-6H,18H2,1-2H3.
What are the key properties of 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline?
2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline has a molecular weight of 290.73 g/mol, XLogP of 4.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4,6-dimethylaniline is sourced from PubChem (CID 82720137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).