About N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine
N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine (PubChem CID 82720453) has the molecular formula C12H14ClFN2O
and a molecular weight of 256.71 g/mol. Its IUPAC name is N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine |
| PubChem CID | 82720453 |
| Molecular Formula | C12H14ClFN2O |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1nc2cc(Cl)c(F)cc2o1 |
| InChI | InChI=1S/C12H14ClFN2O/c1-12(2,3)15-6-11-16-9-4-7(13)8(14)5-10(9)17-11/h4-5,15H,6H2,1-3H3 |
| InChIKey | FCLFMBOZIYHFHP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine (CID 82720453) is N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine is CC(C)(C)NCc1nc2cc(Cl)c(F)cc2o1.
What is the InChIKey of N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine?
The InChIKey is FCLFMBOZIYHFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClFN2O/c1-12(2,3)15-6-11-16-9-4-7(13)8(14)5-10(9)17-11/h4-5,15H,6H2,1-3H3.
What are the key properties of N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine?
N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine has a molecular weight of 256.71 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 82720453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).