About 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine
6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 82720878) has the molecular formula C9H9ClFNO
and a molecular weight of 201.63 g/mol. Its IUPAC name is 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 82720878 |
| Molecular Formula | C9H9ClFNO |
| Molecular Weight | 201.63 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC1CNc2cc(Cl)c(F)cc2O1 |
| InChI | InChI=1S/C9H9ClFNO/c1-5-4-12-8-2-6(10)7(11)3-9(8)13-5/h2-3,5,12H,4H2,1H3 |
| InChIKey | OFQSXECVMLBFBB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine (CID 82720878) is 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine is CC1CNc2cc(Cl)c(F)cc2O1.
What is the InChIKey of 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is OFQSXECVMLBFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClFNO/c1-5-4-12-8-2-6(10)7(11)3-9(8)13-5/h2-3,5,12H,4H2,1H3.
What are the key properties of 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 201.63 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 82720878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).