About 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid
2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid (PubChem CID 82720880) has the molecular formula C10H9ClFNO3
and a molecular weight of 245.64 g/mol. Its IUPAC name is 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid |
| PubChem CID | 82720880 |
| Molecular Formula | C10H9ClFNO3 |
| Molecular Weight | 245.64 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid |
| SMILES | O=C(O)CC1CNc2cc(Cl)c(F)cc2O1 |
| InChI | InChI=1S/C10H9ClFNO3/c11-6-2-8-9(3-7(6)12)16-5(4-13-8)1-10(14)15/h2-3,5,13H,1,4H2,(H,14,15) |
| InChIKey | XMXGZNPBQVECPT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.64 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid?
The IUPAC name of 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid (CID 82720880) is 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid.
What is the SMILES notation for 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid?
The canonical SMILES for 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid is O=C(O)CC1CNc2cc(Cl)c(F)cc2O1.
What is the InChIKey of 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid?
The InChIKey is XMXGZNPBQVECPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClFNO3/c11-6-2-8-9(3-7(6)12)16-5(4-13-8)1-10(14)15/h2-3,5,13H,1,4H2,(H,14,15).
What are the key properties of 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid?
2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid has a molecular weight of 245.64 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid is sourced from PubChem (CID 82720880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).