C5H6F3N5O2 — CID 82721215
3-amino-N-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 82721215) has the molecular formula C5H6F3N5O2 and a molecular weight of 225.13 g/mol. Its IUPAC name is 3-amino-N-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 82721215 |
| Molecular Formula | C5H6F3N5O2 |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 3-amino-N-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)NOCC(F)(F)F)n1 |
| InChI | InChI=1S/C5H6F3N5O2/c6-5(7,8)1-15-13-3(14)2-10-4(9)12-11-2/h1H2,(H,13,14)(H3,9,10,11,12) |
| InChIKey | MDAFTDOXAUCSRS-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|