C10H14F3N3O4 — CID 82721364
2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 82721364) has the molecular formula C10H14F3N3O4 and a molecular weight of 297.23 g/mol. Its IUPAC name is 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 82721364 |
| Molecular Formula | C10H14F3N3O4 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CCC1(C)NC(=O)N(CC(=O)NOCC(F)(F)F)C1=O |
| InChI | InChI=1S/C10H14F3N3O4/c1-3-9(2)7(18)16(8(19)14-9)4-6(17)15-20-5-10(11,12)13/h3-5H2,1-2H3,(H,14,19)(H,15,17) |
| InChIKey | PTUQZXDJFAOGDF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|