About N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide
N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 82721493) has the molecular formula C9H16N4O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide |
| PubChem CID | 82721493 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCCc1nc(C(=O)NOCCOC)n[nH]1 |
| InChI | InChI=1S/C9H16N4O3/c1-3-4-7-10-8(12-11-7)9(14)13-16-6-5-15-2/h3-6H2,1-2H3,(H,13,14)(H,10,11,12) |
| InChIKey | GDGPGNMRWXWUEP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide?
The IUPAC name of N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide (CID 82721493) is N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide?
The canonical SMILES for N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide is CCCc1nc(C(=O)NOCCOC)n[nH]1.
What is the InChIKey of N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide?
The InChIKey is GDGPGNMRWXWUEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O3/c1-3-4-7-10-8(12-11-7)9(14)13-16-6-5-15-2/h3-6H2,1-2H3,(H,13,14)(H,10,11,12).
What are the key properties of N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide?
N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide has a molecular weight of 228.25 g/mol, XLogP of 0.06, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethoxy)-5-propyl-1H-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 82721493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).