About N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide
N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide (PubChem CID 82721631) has the molecular formula C8H11F3N2O2
and a molecular weight of 224.18 g/mol. Its IUPAC name is N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide.
Molecular Properties
| Compound Name | N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide |
| PubChem CID | 82721631 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide |
| SMILES | C#CCNC(=O)C(C)NOCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O2/c1-3-4-12-7(14)6(2)13-15-5-8(9,10)11/h1,6,13H,4-5H2,2H3,(H,12,14) |
| InChIKey | JEXLPCIVLKSJSC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide?
The IUPAC name of N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide (CID 82721631) is N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide.
What is the SMILES notation for N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide?
The canonical SMILES for N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide is C#CCNC(=O)C(C)NOCC(F)(F)F.
What is the InChIKey of N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide?
The InChIKey is JEXLPCIVLKSJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2O2/c1-3-4-12-7(14)6(2)13-15-5-8(9,10)11/h1,6,13H,4-5H2,2H3,(H,12,14).
What are the key properties of N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide?
N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide has a molecular weight of 224.18 g/mol, XLogP of 0.21, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-ynyl-2-(2,2,2-trifluoroethoxyamino)propanamide is sourced from PubChem (CID 82721631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).