C6H7F3N4O2 — CID 82721727
5-methyl-N-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 82721727) has the molecular formula C6H7F3N4O2 and a molecular weight of 224.14 g/mol. Its IUPAC name is 5-methyl-N-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-methyl-N-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 82721727 |
| Molecular Formula | C6H7F3N4O2 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 5-methyl-N-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NOCC(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C6H7F3N4O2/c1-3-10-4(12-11-3)5(14)13-15-2-6(7,8)9/h2H2,1H3,(H,13,14)(H,10,11,12) |
| InChIKey | HQEQTQGZGGJOTC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|