C10H10F3N5O2 — CID 82721850
7-ethyl-N-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 82721850) has the molecular formula C10H10F3N5O2 and a molecular weight of 289.22 g/mol. Its IUPAC name is 7-ethyl-N-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-ethyl-N-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 82721850 |
| Molecular Formula | C10H10F3N5O2 |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 7-ethyl-N-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCc1c(C(=O)NOCC(F)(F)F)cnc2ncnn12 |
| InChI | InChI=1S/C10H10F3N5O2/c1-2-7-6(3-14-9-15-5-16-18(7)9)8(19)17-20-4-10(11,12)13/h3,5H,2,4H2,1H3,(H,17,19) |
| InChIKey | QXLXYCNULYOXLR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|