About 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide
4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide (PubChem CID 82722344) has the molecular formula C8H10F3N3O2S
and a molecular weight of 269.25 g/mol. Its IUPAC name is 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide |
| PubChem CID | 82722344 |
| Molecular Formula | C8H10F3N3O2S |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O2S/c1-4(2)5-6(17-14-12-5)7(15)13-16-3-8(9,10)11/h4H,3H2,1-2H3,(H,13,15) |
| InChIKey | YVIURMCUCMKMRP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide?
The IUPAC name of 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide (CID 82722344) is 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide.
What is the SMILES notation for 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide?
The canonical SMILES for 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide is CC(C)c1nnsc1C(=O)NOCC(F)(F)F.
What is the InChIKey of 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide?
The InChIKey is YVIURMCUCMKMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O2S/c1-4(2)5-6(17-14-12-5)7(15)13-16-3-8(9,10)11/h4H,3H2,1-2H3,(H,13,15).
What are the key properties of 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide?
4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide has a molecular weight of 269.25 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-N-(2,2,2-trifluoroethoxy)thiadiazole-5-carboxamide is sourced from PubChem (CID 82722344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).