About 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol
1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol (PubChem CID 82722386) has the molecular formula C11H22F3NO3
and a molecular weight of 273.29 g/mol. Its IUPAC name is 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol |
| PubChem CID | 82722386 |
| Molecular Formula | C11H22F3NO3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol |
| SMILES | CC(C)CCCOCC(O)CNOCC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO3/c1-9(2)4-3-5-17-7-10(16)6-15-18-8-11(12,13)14/h9-10,15-16H,3-8H2,1-2H3 |
| InChIKey | YVMLNZBINKPLCT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol?
The IUPAC name of 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol (CID 82722386) is 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol.
What is the SMILES notation for 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol?
The canonical SMILES for 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol is CC(C)CCCOCC(O)CNOCC(F)(F)F.
What is the InChIKey of 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol?
The InChIKey is YVMLNZBINKPLCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3NO3/c1-9(2)4-3-5-17-7-10(16)6-15-18-8-11(12,13)14/h9-10,15-16H,3-8H2,1-2H3.
What are the key properties of 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol?
1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol has a molecular weight of 273.29 g/mol, XLogP of 1.88, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylpentoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol is sourced from PubChem (CID 82722386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).