About 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol
1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol (PubChem CID 82722387) has the molecular formula C9H19F3N2O2
and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol |
| PubChem CID | 82722387 |
| Molecular Formula | C9H19F3N2O2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol |
| SMILES | CCN(CC)CC(O)CNOCC(F)(F)F |
| InChI | InChI=1S/C9H19F3N2O2/c1-3-14(4-2)6-8(15)5-13-16-7-9(10,11)12/h8,13,15H,3-7H2,1-2H3 |
| InChIKey | RUVOASIQUJDVFT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol?
The IUPAC name of 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol (CID 82722387) is 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol.
What is the SMILES notation for 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol?
The canonical SMILES for 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol is CCN(CC)CC(O)CNOCC(F)(F)F.
What is the InChIKey of 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol?
The InChIKey is RUVOASIQUJDVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3N2O2/c1-3-14(4-2)6-8(15)5-13-16-7-9(10,11)12/h8,13,15H,3-7H2,1-2H3.
What are the key properties of 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol?
1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol has a molecular weight of 244.26 g/mol, XLogP of 0.77, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethylamino)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol is sourced from PubChem (CID 82722387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).