C11H20BrN3O — CID 82724430
1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N-[(2-methylpropan-2-yl)oxy]methanamine (PubChem CID 82724430) has the molecular formula C11H20BrN3O and a molecular weight of 290.20 g/mol. Its IUPAC name is 1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N-[(2-methylpropan-2-yl)oxy]methanamine.
| Compound Name | 1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N-[(2-methylpropan-2-yl)oxy]methanamine |
|---|---|
| PubChem CID | 82724430 |
| Molecular Formula | C11H20BrN3O |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N-[(2-methylpropan-2-yl)oxy]methanamine |
| SMILES | CCn1nc(C)c(Br)c1CNOC(C)(C)C |
| InChI | InChI=1S/C11H20BrN3O/c1-6-15-9(10(12)8(2)14-15)7-13-16-11(3,4)5/h13H,6-7H2,1-5H3 |
| InChIKey | WGNZEKRDZMOFFF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|