About anthracene-1-carboxamide
anthracene-1-carboxamide (PubChem CID 827252) has the molecular formula C15H11NO
and a molecular weight of 221.26 g/mol. Its IUPAC name is anthracene-1-carboxamide.
Molecular Properties
| Compound Name | anthracene-1-carboxamide |
| PubChem CID | 827252 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | anthracene-1-carboxamide |
| SMILES | NC(=O)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C15H11NO/c16-15(17)13-7-3-6-12-8-10-4-1-2-5-11(10)9-14(12)13/h1-9H,(H2,16,17) |
| InChIKey | UMVFZJRCHRLAGC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-1-carboxamide?
The IUPAC name of anthracene-1-carboxamide (CID 827252) is anthracene-1-carboxamide.
What is the SMILES notation for anthracene-1-carboxamide?
The canonical SMILES for anthracene-1-carboxamide is NC(=O)c1cccc2cc3ccccc3cc12.
What is the InChIKey of anthracene-1-carboxamide?
The InChIKey is UMVFZJRCHRLAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO/c16-15(17)13-7-3-6-12-8-10-4-1-2-5-11(10)9-14(12)13/h1-9H,(H2,16,17).
What are the key properties of anthracene-1-carboxamide?
anthracene-1-carboxamide has a molecular weight of 221.26 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-1-carboxamide is sourced from PubChem (CID 827252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).