About 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine
5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine (PubChem CID 82726233) has the molecular formula C12H15N3OS
and a molecular weight of 249.34 g/mol. Its IUPAC name is 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine |
| PubChem CID | 82726233 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine |
| SMILES | CC1OCCC1Nc1ccc2scnc2c1N |
| InChI | InChI=1S/C12H15N3OS/c1-7-8(4-5-16-7)15-9-2-3-10-12(11(9)13)14-6-17-10/h2-3,6-8,15H,4-5,13H2,1H3 |
| InChIKey | KQYKYERNSAXLKN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine?
The IUPAC name of 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine (CID 82726233) is 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine.
What is the SMILES notation for 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine?
The canonical SMILES for 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine is CC1OCCC1Nc1ccc2scnc2c1N.
What is the InChIKey of 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine?
The InChIKey is KQYKYERNSAXLKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS/c1-7-8(4-5-16-7)15-9-2-3-10-12(11(9)13)14-6-17-10/h2-3,6-8,15H,4-5,13H2,1H3.
What are the key properties of 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine?
5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine has a molecular weight of 249.34 g/mol, XLogP of 2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2-methyloxolan-3-yl)-1,3-benzothiazole-4,5-diamine is sourced from PubChem (CID 82726233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).