C12H15FN2O2 — CID 82727863
2-amino-4-fluoro-N-(2-methyloxolan-3-yl)benzamide (PubChem CID 82727863) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-(2-methyloxolan-3-yl)benzamide.
| Compound Name | 2-amino-4-fluoro-N-(2-methyloxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 82727863 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-amino-4-fluoro-N-(2-methyloxolan-3-yl)benzamide |
| SMILES | CC1OCCC1NC(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C12H15FN2O2/c1-7-11(4-5-17-7)15-12(16)9-3-2-8(13)6-10(9)14/h2-3,6-7,11H,4-5,14H2,1H3,(H,15,16) |
| InChIKey | NFOAQTKXOBLXFI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|