C11H20N2O4 — CID 82728122
2-methyl-4-[(2-methyloxolan-3-yl)carbamoylamino]butanoic acid (PubChem CID 82728122) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-methyl-4-[(2-methyloxolan-3-yl)carbamoylamino]butanoic acid.
| Compound Name | 2-methyl-4-[(2-methyloxolan-3-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 82728122 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-methyl-4-[(2-methyloxolan-3-yl)carbamoylamino]butanoic acid |
| SMILES | CC(CCNC(=O)NC1CCOC1C)C(=O)O |
| InChI | InChI=1S/C11H20N2O4/c1-7(10(14)15)3-5-12-11(16)13-9-4-6-17-8(9)2/h7-9H,3-6H2,1-2H3,(H,14,15)(H2,12,13,16) |
| InChIKey | NPZKOAZBBMCTOD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |