C7H14N2O3S2 — CID 82728589
2-[(2-methyloxolan-3-yl)sulfamoyl]ethanethioamide (PubChem CID 82728589) has the molecular formula C7H14N2O3S2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[(2-methyloxolan-3-yl)sulfamoyl]ethanethioamide.
| Compound Name | 2-[(2-methyloxolan-3-yl)sulfamoyl]ethanethioamide |
|---|---|
| PubChem CID | 82728589 |
| Molecular Formula | C7H14N2O3S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-[(2-methyloxolan-3-yl)sulfamoyl]ethanethioamide |
| SMILES | CC1OCCC1NS(=O)(=O)CC(N)=S |
| InChI | InChI=1S/C7H14N2O3S2/c1-5-6(2-3-12-5)9-14(10,11)4-7(8)13/h5-6,9H,2-4H2,1H3,(H2,8,13) |
| InChIKey | ZYZJMMJGCQAXTG-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|