About 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide
4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide (PubChem CID 82729852) has the molecular formula C12H18N2O5S2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide.
Molecular Properties
| Compound Name | 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide |
| PubChem CID | 82729852 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide |
| SMILES | CC1OCCC1N(C)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-9-12(7-8-19-9)14(2)21(17,18)11-5-3-10(4-6-11)20(13,15)16/h3-6,9,12H,7-8H2,1-2H3,(H2,13,15,16) |
| InChIKey | XRSHIKXFVUSPLJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide?
The IUPAC name of 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide (CID 82729852) is 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide.
What is the SMILES notation for 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide?
The canonical SMILES for 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide is CC1OCCC1N(C)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide?
The InChIKey is XRSHIKXFVUSPLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O5S2/c1-9-12(7-8-19-9)14(2)21(17,18)11-5-3-10(4-6-11)20(13,15)16/h3-6,9,12H,7-8H2,1-2H3,(H2,13,15,16).
What are the key properties of 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide?
4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide has a molecular weight of 334.42 g/mol, XLogP of 0.13, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methyl-4-N-(2-methyloxolan-3-yl)benzene-1,4-disulfonamide is sourced from PubChem (CID 82729852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).