C16H17NO — CID 82730704
(2,5-dimethylphenyl)-(3-ethyl-2-pyridinyl)methanone (PubChem CID 82730704) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-(3-ethyl-2-pyridinyl)methanone.
| Compound Name | (2,5-dimethylphenyl)-(3-ethyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 82730704 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2,5-dimethylphenyl)-(3-ethyl-2-pyridinyl)methanone |
| SMILES | CCc1cccnc1C(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C16H17NO/c1-4-13-6-5-9-17-15(13)16(18)14-10-11(2)7-8-12(14)3/h5-10H,4H2,1-3H3 |
| InChIKey | QJEYNCDMQFDYGF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |