C13H19NO4 — CID 82739295
5-methyl-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]furan-2-carboxylic acid (PubChem CID 82739295) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-methyl-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-methyl-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 82739295 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 5-methyl-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]furan-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CN(C)C1CCOC1C |
| InChI | InChI=1S/C13H19NO4/c1-8-10(6-12(18-8)13(15)16)7-14(3)11-4-5-17-9(11)2/h6,9,11H,4-5,7H2,1-3H3,(H,15,16) |
| InChIKey | BERRMSSLYIBPIF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |