C16H25FN2O — CID 82739889
N-[4-[1-(ethylamino)ethyl]-2-fluorophenyl]-N,2-dimethyloxolan-3-amine (PubChem CID 82739889) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is N-[4-[1-(ethylamino)ethyl]-2-fluorophenyl]-N,2-dimethyloxolan-3-amine.
| Compound Name | N-[4-[1-(ethylamino)ethyl]-2-fluorophenyl]-N,2-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 82739889 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N-[4-[1-(ethylamino)ethyl]-2-fluorophenyl]-N,2-dimethyloxolan-3-amine |
| SMILES | CCNC(C)c1ccc(N(C)C2CCOC2C)c(F)c1 |
| InChI | InChI=1S/C16H25FN2O/c1-5-18-11(2)13-6-7-16(14(17)10-13)19(4)15-8-9-20-12(15)3/h6-7,10-12,15,18H,5,8-9H2,1-4H3 |
| InChIKey | VZHXPMAJEKOTBT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|