About N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide
N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide (PubChem CID 82740649) has the molecular formula C9H17N3O3
and a molecular weight of 215.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide |
| PubChem CID | 82740649 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide |
| SMILES | CN(C(=O)C(=O)NCCN)C1CCOC1 |
| InChI | InChI=1S/C9H17N3O3/c1-12(7-2-5-15-6-7)9(14)8(13)11-4-3-10/h7H,2-6,10H2,1H3,(H,11,13) |
| InChIKey | QOCZQZMEBHWNMR-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide?
The IUPAC name of N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide (CID 82740649) is N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide.
What is the SMILES notation for N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide?
The canonical SMILES for N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide is CN(C(=O)C(=O)NCCN)C1CCOC1.
What is the InChIKey of N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide?
The InChIKey is QOCZQZMEBHWNMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O3/c1-12(7-2-5-15-6-7)9(14)8(13)11-4-3-10/h7H,2-6,10H2,1H3,(H,11,13).
What are the key properties of N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide?
N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide has a molecular weight of 215.25 g/mol, XLogP of -1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-methyl-N'-(oxolan-3-yl)oxamide is sourced from PubChem (CID 82740649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).