About 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide
6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide (PubChem CID 82740652) has the molecular formula C14H22N2O3S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide |
| PubChem CID | 82740652 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide |
| SMILES | Cc1ccc(N)c(S(=O)(=O)N(C)C2CCOC2C)c1C |
| InChI | InChI=1S/C14H22N2O3S/c1-9-5-6-12(15)14(10(9)2)20(17,18)16(4)13-7-8-19-11(13)3/h5-6,11,13H,7-8,15H2,1-4H3 |
| InChIKey | CQLGOWIOZJRZDR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide?
The IUPAC name of 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide (CID 82740652) is 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide.
What is the SMILES notation for 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide?
The canonical SMILES for 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide is Cc1ccc(N)c(S(=O)(=O)N(C)C2CCOC2C)c1C.
What is the InChIKey of 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide?
The InChIKey is CQLGOWIOZJRZDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3S/c1-9-5-6-12(15)14(10(9)2)20(17,18)16(4)13-7-8-19-11(13)3/h5-6,11,13H,7-8,15H2,1-4H3.
What are the key properties of 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide?
6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide has a molecular weight of 298.41 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N,2,3-trimethyl-N-(2-methyloxolan-3-yl)benzenesulfonamide is sourced from PubChem (CID 82740652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).