C9H8ClN3O — CID 82741728
5-chloro-3-(3-ethyl-2-pyridinyl)-1,2,4-oxadiazole (PubChem CID 82741728) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 5-chloro-3-(3-ethyl-2-pyridinyl)-1,2,4-oxadiazole.
| Compound Name | 5-chloro-3-(3-ethyl-2-pyridinyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 82741728 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 5-chloro-3-(3-ethyl-2-pyridinyl)-1,2,4-oxadiazole |
| SMILES | CCc1cccnc1-c1noc(Cl)n1 |
| InChI | InChI=1S/C9H8ClN3O/c1-2-6-4-3-5-11-7(6)8-12-9(10)14-13-8/h3-5H,2H2,1H3 |
| InChIKey | KHRMFACQJSQYEN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |