C14H20F2N2O — CID 82742641
N-[2,6-difluoro-4-(methylaminomethyl)phenyl]-N,2-dimethyloxolan-3-amine (PubChem CID 82742641) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is N-[2,6-difluoro-4-(methylaminomethyl)phenyl]-N,2-dimethyloxolan-3-amine.
| Compound Name | N-[2,6-difluoro-4-(methylaminomethyl)phenyl]-N,2-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 82742641 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[2,6-difluoro-4-(methylaminomethyl)phenyl]-N,2-dimethyloxolan-3-amine |
| SMILES | CNCc1cc(F)c(N(C)C2CCOC2C)c(F)c1 |
| InChI | InChI=1S/C14H20F2N2O/c1-9-13(4-5-19-9)18(3)14-11(15)6-10(8-17-2)7-12(14)16/h6-7,9,13,17H,4-5,8H2,1-3H3 |
| InChIKey | FWIFKRQCEAPYDQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|