C15H28N2O3 — CID 82743238
methyl 1-(ethylamino)-3-[methyl(oxolan-3-yl)amino]cyclohexane-1-carboxylate (PubChem CID 82743238) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is methyl 1-(ethylamino)-3-[methyl(oxolan-3-yl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-(ethylamino)-3-[methyl(oxolan-3-yl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 82743238 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | methyl 1-(ethylamino)-3-[methyl(oxolan-3-yl)amino]cyclohexane-1-carboxylate |
| SMILES | CCNC1(C(=O)OC)CCCC(N(C)C2CCOC2)C1 |
| InChI | InChI=1S/C15H28N2O3/c1-4-16-15(14(18)19-3)8-5-6-12(10-15)17(2)13-7-9-20-11-13/h12-13,16H,4-11H2,1-3H3 |
| InChIKey | DCLTUEJSTALFEQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |