About N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine
N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine (PubChem CID 82744008) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine |
| PubChem CID | 82744008 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine |
| SMILES | CCNC1CC(C)CC(C)C1CN(C)C1CCOC1C |
| InChI | InChI=1S/C17H34N2O/c1-6-18-16-10-12(2)9-13(3)15(16)11-19(5)17-7-8-20-14(17)4/h12-18H,6-11H2,1-5H3 |
| InChIKey | LDUNXAIDIPKIPY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine?
The IUPAC name of N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine (CID 82744008) is N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine.
What is the SMILES notation for N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine?
The canonical SMILES for N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine is CCNC1CC(C)CC(C)C1CN(C)C1CCOC1C.
What is the InChIKey of N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine?
The InChIKey is LDUNXAIDIPKIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O/c1-6-18-16-10-12(2)9-13(3)15(16)11-19(5)17-7-8-20-14(17)4/h12-18H,6-11H2,1-5H3.
What are the key properties of N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine?
N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine has a molecular weight of 282.47 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(ethylamino)-4,6-dimethylcyclohexyl]methyl]-N,2-dimethyloxolan-3-amine is sourced from PubChem (CID 82744008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).