C10H18N4OS — CID 82744226
N-methyl-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]thiadiazol-5-amine (PubChem CID 82744226) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is N-methyl-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]thiadiazol-5-amine.
| Compound Name | N-methyl-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]thiadiazol-5-amine |
|---|---|
| PubChem CID | 82744226 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-methyl-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]thiadiazol-5-amine |
| SMILES | CNc1snnc1CN(C)C1CCOC1C |
| InChI | InChI=1S/C10H18N4OS/c1-7-9(4-5-15-7)14(3)6-8-10(11-2)16-13-12-8/h7,9,11H,4-6H2,1-3H3 |
| InChIKey | ZMPIGYXEQXJECX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |