C12H20N4O — CID 82744388
N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethyloxolan-3-amine (PubChem CID 82744388) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethyloxolan-3-amine.
| Compound Name | N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 82744388 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethyloxolan-3-amine |
| SMILES | CC1OCCC1N(C)Cc1ccnc(NN)c1 |
| InChI | InChI=1S/C12H20N4O/c1-9-11(4-6-17-9)16(2)8-10-3-5-14-12(7-10)15-13/h3,5,7,9,11H,4,6,8,13H2,1-2H3,(H,14,15) |
| InChIKey | BJUWSXDQDWLJEM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|