About N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine
N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine (PubChem CID 82745755) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine |
| PubChem CID | 82745755 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine |
| SMILES | CC1OCCC1N(C)Cc1cccc2c1NCC2 |
| InChI | InChI=1S/C15H22N2O/c1-11-14(7-9-18-11)17(2)10-13-5-3-4-12-6-8-16-15(12)13/h3-5,11,14,16H,6-10H2,1-2H3 |
| InChIKey | FOTYBJSHDANAAW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine?
The IUPAC name of N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine (CID 82745755) is N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine.
What is the SMILES notation for N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine?
The canonical SMILES for N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine is CC1OCCC1N(C)Cc1cccc2c1NCC2.
What is the InChIKey of N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine?
The InChIKey is FOTYBJSHDANAAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O/c1-11-14(7-9-18-11)17(2)10-13-5-3-4-12-6-8-16-15(12)13/h3-5,11,14,16H,6-10H2,1-2H3.
What are the key properties of N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine?
N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine has a molecular weight of 246.35 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,2-dimethyloxolan-3-amine is sourced from PubChem (CID 82745755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).