About 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine
2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine (PubChem CID 82745822) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine |
| PubChem CID | 82745822 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine |
| SMILES | CCc1cccnc1CN1CC(C)(C)NCC1CC |
| InChI | InChI=1S/C16H27N3/c1-5-13-8-7-9-17-15(13)11-19-12-16(3,4)18-10-14(19)6-2/h7-9,14,18H,5-6,10-12H2,1-4H3 |
| InChIKey | GZBXRDUKVVZESS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine?
The IUPAC name of 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine (CID 82745822) is 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine.
What is the SMILES notation for 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine?
The canonical SMILES for 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine is CCc1cccnc1CN1CC(C)(C)NCC1CC.
What is the InChIKey of 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine?
The InChIKey is GZBXRDUKVVZESS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3/c1-5-13-8-7-9-17-15(13)11-19-12-16(3,4)18-10-14(19)6-2/h7-9,14,18H,5-6,10-12H2,1-4H3.
What are the key properties of 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine?
2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine has a molecular weight of 261.41 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-[(3-ethyl-2-pyridinyl)methyl]-5,5-dimethylpiperazine is sourced from PubChem (CID 82745822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).