C15H17ClN2 — CID 82746847
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-chlorobenzonitrile (PubChem CID 82746847) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-chlorobenzonitrile.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 82746847 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C15H17ClN2/c16-13-5-6-15(12(9-13)10-17)18-8-7-11-3-1-2-4-14(11)18/h5-6,9,11,14H,1-4,7-8H2 |
| InChIKey | MMJUNEWBYWEHRC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |