About N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine
N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine (PubChem CID 82748423) has the molecular formula C14H23ClN2OS
and a molecular weight of 302.87 g/mol. Its IUPAC name is N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine |
| PubChem CID | 82748423 |
| Molecular Formula | C14H23ClN2OS |
| Molecular Weight | 302.87 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine |
| SMILES | CC1OCCC1N(C)CCCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C14H23ClN2OS/c1-11-13(6-8-18-11)17(2)7-4-3-5-14-16-12(9-15)10-19-14/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | RPFAOPPHKUWEHG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.87 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine?
The IUPAC name of N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine (CID 82748423) is N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine.
What is the SMILES notation for N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine?
The canonical SMILES for N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine is CC1OCCC1N(C)CCCCc1nc(CCl)cs1.
What is the InChIKey of N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine?
The InChIKey is RPFAOPPHKUWEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23ClN2OS/c1-11-13(6-8-18-11)17(2)7-4-3-5-14-16-12(9-15)10-19-14/h10-11,13H,3-9H2,1-2H3.
What are the key properties of N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine?
N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine has a molecular weight of 302.87 g/mol, XLogP of 3.31, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-N,2-dimethyloxolan-3-amine is sourced from PubChem (CID 82748423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).