About 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine
4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine (PubChem CID 82748550) has the molecular formula C12H15ClN6O
and a molecular weight of 294.75 g/mol. Its IUPAC name is 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine |
| PubChem CID | 82748550 |
| Molecular Formula | C12H15ClN6O |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine |
| SMILES | CC1OCCC1N(C)c1nc(Cl)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H15ClN6O/c1-8-9(3-6-20-8)18(2)11-15-10(13)16-12(17-11)19-5-4-14-7-19/h4-5,7-9H,3,6H2,1-2H3 |
| InChIKey | GVLLDGJFGOMVSZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine?
The IUPAC name of 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine (CID 82748550) is 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine?
The canonical SMILES for 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine is CC1OCCC1N(C)c1nc(Cl)nc(-n2ccnc2)n1.
What is the InChIKey of 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine?
The InChIKey is GVLLDGJFGOMVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN6O/c1-8-9(3-6-20-8)18(2)11-15-10(13)16-12(17-11)19-5-4-14-7-19/h4-5,7-9H,3,6H2,1-2H3.
What are the key properties of 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine?
4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine has a molecular weight of 294.75 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-imidazol-1-yl-N-methyl-N-(2-methyloxolan-3-yl)-1,3,5-triazin-2-amine is sourced from PubChem (CID 82748550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).