C13H17BrN2O4S — CID 82749448
3-bromo-N,2-dimethyl-N-(oxolan-3-yl)-5-sulfamoylbenzamide (PubChem CID 82749448) has the molecular formula C13H17BrN2O4S and a molecular weight of 377.26 g/mol. Its IUPAC name is 3-bromo-N,2-dimethyl-N-(oxolan-3-yl)-5-sulfamoylbenzamide.
| Compound Name | 3-bromo-N,2-dimethyl-N-(oxolan-3-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 82749448 |
| Molecular Formula | C13H17BrN2O4S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 3-bromo-N,2-dimethyl-N-(oxolan-3-yl)-5-sulfamoylbenzamide |
| SMILES | Cc1c(Br)cc(S(N)(=O)=O)cc1C(=O)N(C)C1CCOC1 |
| InChI | InChI=1S/C13H17BrN2O4S/c1-8-11(5-10(6-12(8)14)21(15,18)19)13(17)16(2)9-3-4-20-7-9/h5-6,9H,3-4,7H2,1-2H3,(H2,15,18,19) |
| InChIKey | SAHYTESWNVDPKA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |