C16H19NO3 — CID 82749477
5-(3-hydroxyprop-1-ynyl)-N,2-dimethyl-N-(oxolan-3-yl)benzamide (PubChem CID 82749477) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N,2-dimethyl-N-(oxolan-3-yl)benzamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N,2-dimethyl-N-(oxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 82749477 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N,2-dimethyl-N-(oxolan-3-yl)benzamide |
| SMILES | Cc1ccc(C#CCO)cc1C(=O)N(C)C1CCOC1 |
| InChI | InChI=1S/C16H19NO3/c1-12-5-6-13(4-3-8-18)10-15(12)16(19)17(2)14-7-9-20-11-14/h5-6,10,14,18H,7-9,11H2,1-2H3 |
| InChIKey | ZXGUYVVEXNKBJC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|