About N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine
N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine (PubChem CID 82749499) has the molecular formula C9H18N4O
and a molecular weight of 198.27 g/mol. Its IUPAC name is N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine |
| PubChem CID | 82749499 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine |
| SMILES | CC1OCCC1N(C)CCCN=[N+]=[N-] |
| InChI | InChI=1S/C9H18N4O/c1-8-9(4-7-14-8)13(2)6-3-5-11-12-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | CFVIHQMWHNIRCK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine?
The IUPAC name of N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine (CID 82749499) is N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine.
What is the SMILES notation for N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine?
The canonical SMILES for N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine is CC1OCCC1N(C)CCCN=[N+]=[N-].
What is the InChIKey of N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine?
The InChIKey is CFVIHQMWHNIRCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O/c1-8-9(4-7-14-8)13(2)6-3-5-11-12-10/h8-9H,3-7H2,1-2H3.
What are the key properties of N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine?
N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine has a molecular weight of 198.27 g/mol, XLogP of 1.80, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-azidopropyl)-N,2-dimethyloxolan-3-amine is sourced from PubChem (CID 82749499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).