C12H24BrNO — CID 82749590
N-[2-(bromomethyl)pentyl]-N,2-dimethyloxolan-3-amine (PubChem CID 82749590) has the molecular formula C12H24BrNO and a molecular weight of 278.23 g/mol. Its IUPAC name is N-[2-(bromomethyl)pentyl]-N,2-dimethyloxolan-3-amine.
| Compound Name | N-[2-(bromomethyl)pentyl]-N,2-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 82749590 |
| Molecular Formula | C12H24BrNO |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-[2-(bromomethyl)pentyl]-N,2-dimethyloxolan-3-amine |
| SMILES | CCCC(CBr)CN(C)C1CCOC1C |
| InChI | InChI=1S/C12H24BrNO/c1-4-5-11(8-13)9-14(3)12-6-7-15-10(12)2/h10-12H,4-9H2,1-3H3 |
| InChIKey | ILLYWTURSVYVBI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|