C12H22ClNO2S — CID 82749613
1-(3-chloro-2-methylpropyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 82749613) has the molecular formula C12H22ClNO2S and a molecular weight of 279.83 g/mol. Its IUPAC name is 1-(3-chloro-2-methylpropyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(3-chloro-2-methylpropyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 82749613 |
| Molecular Formula | C12H22ClNO2S |
| Molecular Weight | 279.83 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(3-chloro-2-methylpropyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | CC(CCl)CS(=O)(=O)N1CCC2CCCCC21 |
| InChI | InChI=1S/C12H22ClNO2S/c1-10(8-13)9-17(15,16)14-7-6-11-4-2-3-5-12(11)14/h10-12H,2-9H2,1H3 |
| InChIKey | VPCNXYXXGGECMT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.83 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|