C16H21NO3 — CID 82749840
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-(2,4-dihydroxyphenyl)ethanone (PubChem CID 82749840) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-(2,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-(2,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 82749840 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-(2,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(CN1CCC2CCCCC21)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H21NO3/c18-12-5-6-13(15(19)9-12)16(20)10-17-8-7-11-3-1-2-4-14(11)17/h5-6,9,11,14,18-19H,1-4,7-8,10H2 |
| InChIKey | OLOJJRHSGGKYJW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |