About 2-(4-nitrophenyl)-1,3-benzothiazole
2-(4-nitrophenyl)-1,3-benzothiazole (PubChem CID 827500) has the molecular formula C13H8N2O2S
and a molecular weight of 256.29 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-1,3-benzothiazole |
| PubChem CID | 827500 |
| Molecular Formula | C13H8N2O2S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-(4-nitrophenyl)-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C13H8N2O2S/c16-15(17)10-7-5-9(6-8-10)13-14-11-3-1-2-4-12(11)18-13/h1-8H |
| InChIKey | KEJBDGQLLLLBGE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-1,3-benzothiazole?
The IUPAC name of 2-(4-nitrophenyl)-1,3-benzothiazole (CID 827500) is 2-(4-nitrophenyl)-1,3-benzothiazole.
What is the SMILES notation for 2-(4-nitrophenyl)-1,3-benzothiazole?
The canonical SMILES for 2-(4-nitrophenyl)-1,3-benzothiazole is O=[N+]([O-])c1ccc(-c2nc3ccccc3s2)cc1.
What is the InChIKey of 2-(4-nitrophenyl)-1,3-benzothiazole?
The InChIKey is KEJBDGQLLLLBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2S/c16-15(17)10-7-5-9(6-8-10)13-14-11-3-1-2-4-12(11)18-13/h1-8H.
What are the key properties of 2-(4-nitrophenyl)-1,3-benzothiazole?
2-(4-nitrophenyl)-1,3-benzothiazole has a molecular weight of 256.29 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-1,3-benzothiazole is sourced from PubChem (CID 827500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).