C16H29NO — CID 82750366
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)cyclooctan-1-ol (PubChem CID 82750366) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)cyclooctan-1-ol.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)cyclooctan-1-ol |
|---|---|
| PubChem CID | 82750366 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)cyclooctan-1-ol |
| SMILES | OC1CCCCCCC1N1CCC2CCCCC21 |
| InChI | InChI=1S/C16H29NO/c18-16-10-4-2-1-3-9-15(16)17-12-11-13-7-5-6-8-14(13)17/h13-16,18H,1-12H2 |
| InChIKey | CHKCCUOMJGCXOS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |